CAS 874468-54-9
:5-(4-Amino-2-chlorophenyl)-2-furanmethanol
Description:
5-(4-Amino-2-chlorophenyl)-2-furanmethanol, identified by its CAS number 874468-54-9, is an organic compound characterized by its unique structural features, which include a furan ring and an amino-substituted aromatic system. This compound typically exhibits properties associated with both the furan and aromatic functionalities, such as potential reactivity in electrophilic substitution reactions due to the presence of the amino group. The chlorophenyl moiety may influence its electronic properties and solubility, while the hydroxymethyl group contributes to its potential for hydrogen bonding. The compound may also display biological activity, making it of interest in medicinal chemistry and pharmacology. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be evaluated for its potential applications in drug development or as a chemical intermediate. As with many organic compounds, its stability, solubility, and reactivity can vary based on environmental conditions and the presence of other functional groups.
Formula:C11H10ClNO2
InChI:InChI=1S/C11H10ClNO2/c12-10-5-7(13)1-3-9(10)11-4-2-8(6-14)15-11/h1-5,14H,6,13H2
InChI key:InChIKey=RWUGRGDUCVDTDI-UHFFFAOYSA-N
SMILES:ClC1=C(C=2OC(CO)=CC2)C=CC(N)=C1
Synonyms:- 2-Furanmethanol, 5-(4-amino-2-chlorophenyl)-
- 5-(4-Amino-2-chlorophenyl)-2-furanmethanol
- [5-(4-Amino-2-chlorophenyl)furan-2-yl]methanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.