CAS 87447-47-0
:(2S-cis)-3-(acetyloxy)-2,3-dihydro-2-*(4-methoxyp
Description:
The chemical substance with the name "(2S-cis)-3-(acetyloxy)-2,3-dihydro-2-(4-methoxy)" and CAS number 87447-47-0 is a derivative of a dihydro compound, characterized by the presence of an acetyloxy functional group and a methoxy substituent. This compound likely exhibits chirality due to the presence of a stereocenter, which can influence its biological activity and interactions. The acetyloxy group suggests potential reactivity, allowing for further chemical modifications or reactions, while the methoxy group may enhance lipophilicity and affect solubility in organic solvents. The dihydro structure indicates that the compound may have a cyclic or partially saturated framework, which can contribute to its stability and reactivity. Such compounds often find applications in pharmaceuticals or as intermediates in organic synthesis, owing to their unique structural features and functional groups. Understanding the specific properties, such as melting point, boiling point, and solubility, would require experimental data or literature references for comprehensive insights into its behavior in various chemical contexts.
Formula:C18H17NO4S
InChI:InChI=1/C18H17NO4S/c1-11(20)23-16-17(12-7-9-13(22-2)10-8-12)24-15-6-4-3-5-14(15)19-18(16)21/h3-10,16-17H,1-2H3,(H,19,21)/t16-,17+/m1/s1
Synonyms:- (2S,3S)-2-(4-methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl acetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(2S,3S)-2-(4-Methoxyphenyl)-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl acetate
CAS:Formula:C18H17NO4SPurity:97%Color and Shape:SolidMolecular weight:343.3969Diltiazem EP Impurity B
CAS:Formula:C18H17NO4SColor and Shape:White To Off-White SolidMolecular weight:343.40(2S,3S)-2-(4-Methoxyphenyl)-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl acetate (Diltiazem Impurity)
CAS:<p>(2S,3S)-2-(4-Methoxyphenyl)-4-oxo-2,3,4,5-tetrahydrobenzo[b][1,4]thiazepin-3-yl acetate (Diltiazem Impurity)</p>Purity:98%(2S,3S)-2-(4-Methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl Acetate
CAS:Controlled ProductFormula:C18H17NO4SColor and Shape:NeatMolecular weight:343.40Des[5-(2-dimethylamino)ethyl] Diltiazem
CAS:Controlled Product<p>Applications Diltiazem (D460620) intermediate (impurity B).<br>References Chaffman, M., et al.: Drugs, 29, 387 (1985), Kamath, B., et al.: J. Pharm. Biomed. Anal., 11, 407 (1993), Chankvetadze, B., et al.: J. Pharm. Biomed. Anal., 27, 161 (2002),<br></p>Formula:C18H17NO4SColor and Shape:NeatMolecular weight:343.40Des[5-(2-dimethylamino)ethyl] diltiazem
CAS:<p>Please enquire for more information about Des[5-(2-dimethylamino)ethyl] diltiazem including the price, delivery time and more detailed product information at the technical inquiry form on this page</p>Formula:C18H17NO4SPurity:Min. 95%Molecular weight:343.4 g/mol(2S,3S)-2-(4-Methoxyphenyl)-4-oxo-2,3,4,5-tetrahydro-1,5-benzothiazepin-3-yl Acetate
CAS:Color and Shape:Neat








