CAS 874482-98-1

Benzenemethanamine, 2-chloro-4-(trifluoromethoxy)-, hydrochloride

Description:

Benzenemethanamine, 2-chloro-4-(trifluoromethoxy)-, hydrochloride, with the CAS number 874482-98-1, is a chemical compound characterized by its aromatic amine structure. It features a benzene ring substituted with a chlorinated and trifluoromethoxy group, which contributes to its unique chemical properties. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceuticals. This compound may exhibit biological activity due to its amine functionality, which can interact with biological systems. Its trifluoromethoxy group can influence its lipophilicity and metabolic stability, potentially affecting its pharmacokinetic properties. As with many halogenated compounds, it may also exhibit specific reactivity patterns, making it of interest in synthetic organic chemistry. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₈H₇ClF₃NOClH

InChI: InChI=1S/C8H7ClF3NO.ClH/c9-7-3-6(14-8(10,11)12)2-1-5(7)4-13;/h1-3H,4,13H2;1H

InChI key: DQDLTBCJSLLPIW-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1OC(F)(F)F)Cl)CN.Cl