CAS 874493-49-9
:5-Bromo-1-hydroxy-2(1H)-pyridinone
Description:
5-Bromo-1-hydroxy-2(1H)-pyridinone, with the CAS number 874493-49-9, is a heterocyclic organic compound characterized by its pyridinone structure, which includes a bromine substituent and a hydroxyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as stability and the ability to participate in various chemical reactions. The presence of the bromine atom enhances its reactivity, making it useful in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. The hydroxyl group contributes to its potential as a chelating agent, allowing it to form complexes with metal ions. Additionally, 5-Bromo-1-hydroxy-2(1H)-pyridinone may exhibit biological activity, which can be explored for medicinal applications. Its solubility and stability in different solvents can vary, influencing its practical applications in research and industry. Overall, this compound is of interest for its unique structural features and potential utility in various chemical and biological contexts.
Formula:C5H4BrNO2
InChI:InChI=1S/C5H4BrNO2/c6-4-1-2-5(8)7(9)3-4/h1-3,9H
InChI key:InChIKey=TYSIOVAYSVFULC-UHFFFAOYSA-N
SMILES:ON1C(=O)C=CC(Br)=C1
Synonyms:- 5-Bromo-1-hydroxy-2(1H)-pyridinone
- 2(1H)-Pyridinone, 5-bromo-1-hydroxy-
- 2(1H)-Pyridone, 5-bromo-1-hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
