CAS 874504-11-7
:4-(2-bromo-1,2-diphenylethenyl)phenol
Description:
4-(2-Bromo-1,2-diphenylethenyl)phenol, identified by its CAS number 874504-11-7, is an organic compound characterized by its complex structure, which includes a phenolic group and a bromo-substituted diphenylethenyl moiety. This compound typically exhibits properties associated with both phenols and brominated organic compounds, such as moderate solubility in organic solvents and potential reactivity due to the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The phenolic hydroxyl group contributes to its acidity and potential for hydrogen bonding, influencing its solubility and reactivity in various chemical environments. Additionally, the presence of multiple aromatic rings suggests that the compound may exhibit significant stability and unique electronic properties, making it of interest in fields such as organic synthesis and materials science. Its specific applications may vary, but compounds of this nature are often explored for their potential use in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis.
Formula:C20H15BrO
InChI:InChI=1/C20H15BrO/c21-20(17-9-5-2-6-10-17)19(15-7-3-1-4-8-15)16-11-13-18(22)14-12-16/h1-14,22H
SMILES:c1ccc(cc1)C(=C(c1ccccc1)Br)c1ccc(cc1)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
(E,Z)-1-Bromo-1,2-diphenyl-2-(4-hydroxyphenyl)ethene
CAS:Formula:C20H15BrOColor and Shape:SolidMolecular weight:351.2365
