CAS 87454-49-7
:N-[3-{[(4-bromophenyl)amino]methyl}-3-chloro-2-(3,4-dichlorophenyl)-4-oxoazetidin-1-yl]-2-hydroxybenzamide
Description:
N-[3-{[(4-bromophenyl)amino]methyl}-3-chloro-2-(3,4-dichlorophenyl)-4-oxoazetidin-1-yl]-2-hydroxybenzamide, with the CAS number 87454-49-7, is a synthetic organic compound characterized by its complex molecular structure, which includes an azetidine ring, multiple aromatic systems, and various functional groups such as amine, hydroxyl, and amide. This compound exhibits potential biological activity, often investigated for its pharmacological properties, particularly in the context of medicinal chemistry. The presence of halogen substituents, such as bromine and chlorine, may influence its reactivity and interaction with biological targets. The hydroxyl group contributes to its solubility and potential hydrogen bonding capabilities, while the amide linkage can enhance stability and bioavailability. Overall, this compound's unique structural features suggest it may have applications in drug development, particularly in targeting specific diseases or conditions, although further studies would be necessary to fully elucidate its properties and efficacy.
Formula:C23H17BrCl3N3O3
InChI:InChI=1/C23H17BrCl3N3O3/c24-14-6-8-15(9-7-14)28-12-23(27)20(13-5-10-17(25)18(26)11-13)30(22(23)33)29-21(32)16-3-1-2-4-19(16)31/h1-11,20,28,31H,12H2,(H,29,32)
Synonyms:- N-[3-[[(4-bromophenyl)amino]methyl]-3-chloro-2-(3,4-dichlorophenyl)-4- oxo-azetidin-1-yl]-2-hydroxy-benzamide
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Benzamide,N-[3-[[(4-bromophenyl)amino]methyl]-3-chloro-2-(3,4-dichlorophenyl)-4-oxo-1-azetidinyl]-2-hydroxy-
CAS:Formula:C23H17BrCl3N3O3Molecular weight:569.6624
