CymitQuimica logo

CAS 874591-55-6

:

2-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine

Description:
2-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a triazole and thiadiazole moiety fused together. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, making it of interest in medicinal chemistry. The presence of the ethyl group and the amino group on the benzene ring may influence its solubility, reactivity, and interaction with biological targets. The compound's molecular framework suggests it could participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Additionally, its unique structure may confer specific pharmacological properties, potentially making it a candidate for drug development. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature. Overall, 2-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine represents a fascinating subject for further research in both synthetic and applied chemistry.
Formula:C11H11N5S
InChI:InChI=1S/C11H11N5S/c1-2-9-13-14-11-16(9)15-10(17-11)7-5-3-4-6-8(7)12/h3-6H,2,12H2,1H3
InChI key:InChIKey=XMWXVAHGFYPRRS-UHFFFAOYSA-N
SMILES:C(C)C=1N2C(SC(=N2)C3=C(N)C=CC=C3)=NN1
Synonyms:
  • 2-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine
  • Benzenamine, 2-(3-ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.