
CAS 874591-57-8
:3-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine
Description:
3-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine is a chemical compound characterized by its complex structure, which includes a triazole and thiadiazole moiety fused together, contributing to its potential biological activity. The presence of the ethyl group enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The benzenamine part of the molecule indicates that it has an amine functional group, which can participate in hydrogen bonding and may be crucial for its interaction with biological targets. This compound is likely to exhibit properties such as antimicrobial or antifungal activity, given the presence of heterocyclic rings, which are often associated with pharmacological effects. Its specific applications and efficacy would depend on further studies, including in vitro and in vivo evaluations. As with many synthetic compounds, safety and handling precautions should be observed, and its stability under various conditions should be assessed for practical applications.
Formula:C11H11N5S
InChI:InChI=1S/C11H11N5S/c1-2-9-13-14-11-16(9)15-10(17-11)7-4-3-5-8(12)6-7/h3-6H,2,12H2,1H3
InChI key:InChIKey=BMZLSIKQZVEEEV-UHFFFAOYSA-N
SMILES:C(C)C=1N2C(SC(=N2)C3=CC(N)=CC=C3)=NN1
Synonyms:- Benzenamine, 3-(3-ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)-
- 3-(3-Ethyl-1,2,4-triazolo[3,4-b][1,3,4]thiadiazol-6-yl)benzenamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.