CymitQuimica logo

CAS 874594-01-1

:

N-[1-[4-(2-Amino-4-thiazolyl)phenyl]ethyl]acetamide

Description:
N-[1-[4-(2-Amino-4-thiazolyl)phenyl]ethyl]acetamide, with the CAS number 874594-01-1, is a chemical compound characterized by its complex structure, which includes an acetamide functional group and a thiazole moiety. This compound typically exhibits properties associated with both amines and amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The presence of the thiazole ring contributes to its biological activity, making it of interest in pharmaceutical research, particularly in the development of therapeutic agents. The compound may also display moderate to high melting and boiling points, depending on its molecular interactions. Additionally, it may possess specific reactivity patterns due to the functional groups present, which can influence its stability and interactions with other chemical species. Overall, N-[1-[4-(2-Amino-4-thiazolyl)phenyl]ethyl]acetamide is a compound of interest in medicinal chemistry, with potential applications in drug development and biological studies.
Formula:C13H15N3OS
InChI:InChI=1S/C13H15N3OS/c1-8(15-9(2)17)10-3-5-11(6-4-10)12-7-18-13(14)16-12/h3-8H,1-2H3,(H2,14,16)(H,15,17)
InChI key:InChIKey=PIUIOPXUSXKZAE-UHFFFAOYSA-N
SMILES:NC1=NC(=CS1)C2=CC=C(C(NC(C)=O)C)C=C2
Synonyms:
  • Acetamide, N-[1-[4-(2-amino-4-thiazolyl)phenyl]ethyl]-
  • N-[1-[4-(2-Amino-4-thiazolyl)phenyl]ethyl]acetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.