CAS 874594-04-4

2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-(2-thienyl)ethanone

Description:

2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-(2-thienyl)ethanone is a synthetic organic compound characterized by its complex structure, which includes a benzimidazole moiety and a thienyl group. The presence of the difluoromethyl group enhances its reactivity and may influence its biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential stability under standard laboratory conditions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of heteroatoms and functional groups that can interact with biological targets. The compound may also exhibit interesting electronic properties owing to the conjugated system formed by the thienyl and benzimidazole rings. As with many synthetic compounds, its safety profile, including toxicity and environmental impact, would need to be assessed through appropriate studies. Overall, this compound represents a class of molecules that could be of interest for further research in drug development and material science.

Formula: C₁₄H₁₀F₂N₂OS

InChI: InChI=1S/C14H10F2N2OS/c15-14(16)18-10-5-2-1-4-9(10)17-13(18)8-11(19)12-6-3-7-20-12/h1-7,14H,8H2

InChI key: InChIKey=AYIRZVBQLHRDAP-UHFFFAOYSA-N

SMILES: C(F)(F)N1C=2C(N=C1CC(=O)C3=CC=CS3)=CC=CC2

Synonyms:

• Ethanone, 2-[1-(difluoromethyl)-1H-benzimidazol-2-yl]-1-(2-thienyl)-
• 2-[1-(Difluoromethyl)-1H-benzimidazol-2-yl]-1-(2-thienyl)ethanone

2-[1-(Difluoromethyl)-1H-1,3-benzodiazol-2-yl]-1-(thiophen-2-yl)ethan-1-one

Controlled Product

CAS: 874594-04-4

Versatile small molecule scaffold

Formula: C₁₄H₁₀F₂N₂OS

Purity: Min. 95%

Molecular weight: 292.31 g/mol

Ref: 3D-ZJB59404