CAS 874594-11-3

3-[(2-Thienylsulfonyl)amino]-2-naphthalenecarboxylic acid

Description:

3-[(2-Thienylsulfonyl)amino]-2-naphthalenecarboxylic acid, with the CAS number 874594-11-3, is a chemical compound characterized by its unique structural features, which include a naphthalene ring system and a thienylsulfonyl group. This compound typically exhibits properties associated with both aromatic and sulfonamide functionalities, contributing to its potential biological activity. The presence of the carboxylic acid group suggests it can participate in hydrogen bonding and may exhibit acidic behavior in solution. Additionally, the thienylsulfonyl moiety may enhance the compound's solubility and reactivity, making it of interest in medicinal chemistry and drug design. The compound's structure allows for various interactions with biological targets, potentially influencing its pharmacological properties. Overall, 3-[(2-Thienylsulfonyl)amino]-2-naphthalenecarboxylic acid represents a class of compounds that may have applications in therapeutic contexts, although specific biological activities would require further investigation through experimental studies.

Formula: C₁₅H₁₁NO₄S₂

InChI: InChI=1S/C15H11NO4S2/c17-15(18)12-8-10-4-1-2-5-11(10)9-13(12)16-22(19,20)14-6-3-7-21-14/h1-9,16H,(H,17,18)

InChI key: InChIKey=IFDALHUCEBEPTN-UHFFFAOYSA-N

SMILES: N(S(=O)(=O)C1=CC=CS1)C=2C(C(O)=O)=CC3=C(C2)C=CC=C3

Synonyms:

• 2-Naphthalenecarboxylic acid, 3-[(2-thienylsulfonyl)amino]-
• 3-[(2-Thienylsulfonyl)amino]-2-naphthalenecarboxylic acid