CAS 874594-87-3

2-Chloro-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide

Description:

2-Chloro-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide is a chemical compound characterized by its unique structural features, including a chloro substituent, a cyclopropyl group, and a methoxyphenyl moiety. This compound belongs to the class of acetamides, which are derivatives of acetic acid where the hydrogen atom of the carboxyl group is replaced by an amine or amide group. The presence of the chloro group introduces reactivity, potentially influencing its biological activity and solubility. The cyclopropyl group contributes to the compound's three-dimensional structure, which can affect its interaction with biological targets. The methoxyphenyl group enhances lipophilicity, potentially improving membrane permeability. This compound may exhibit pharmacological properties, making it of interest in medicinal chemistry, particularly in the development of therapeutic agents. Its specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Safety and handling precautions are essential due to the presence of the chloro group, which can pose health risks.

Formula: C₁₃H₁₆ClNO₂

InChI: InChI=1S/C13H16ClNO2/c1-17-12-6-2-10(3-7-12)9-15(11-4-5-11)13(16)8-14/h2-3,6-7,11H,4-5,8-9H2,1H3

InChI key: InChIKey=MTGYGBNCPKSKCI-UHFFFAOYSA-N

SMILES: N(CC1=CC=C(OC)C=C1)(C(CCl)=O)C2CC2

Synonyms:

• Acetamide, 2-chloro-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]-
• 2-Chloro-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide

2-Chloro-N-cyclopropyl-N-[(4-methoxyphenyl)methyl]acetamide

CAS: 874594-87-3

Versatile small molecule scaffold

Formula: C₁₃H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 253.72 g/mol

Ref: 3D-ZJB59487