CymitQuimica logo

CAS 874594-88-4

:

4-(1,1-Dimethylethyl)benzoic acid 2-(2-chloroacetyl)hydrazide

Description:
4-(1,1-Dimethylethyl)benzoic acid 2-(2-chloroacetyl)hydrazide, with the CAS number 874594-88-4, is a chemical compound that features a hydrazide functional group attached to a benzoic acid derivative. This compound is characterized by its hydrophobic nature due to the presence of the bulky tert-butyl group, which can influence its solubility and interaction with biological systems. The chloroacetyl moiety introduces reactivity, making it a potential candidate for further chemical modifications or applications in medicinal chemistry. The presence of both hydrophobic and polar functional groups suggests that it may exhibit interesting pharmacological properties, potentially acting as an intermediate in the synthesis of more complex molecules. Additionally, the compound may be studied for its potential biological activities, including antimicrobial or anti-inflammatory effects, although specific biological data would need to be referenced from empirical studies. Overall, this compound represents a unique structure that could be of interest in various fields, including organic synthesis and drug development.
Formula:C13H17ClN2O2
InChI:InChI=1S/C13H17ClN2O2/c1-13(2,3)10-6-4-9(5-7-10)12(18)16-15-11(17)8-14/h4-7H,8H2,1-3H3,(H,15,17)(H,16,18)
InChI key:InChIKey=YYEKYRASPNSQDE-UHFFFAOYSA-N
SMILES:C(NNC(CCl)=O)(=O)C1=CC=C(C(C)(C)C)C=C1
Synonyms:
  • 4-(1,1-Dimethylethyl)benzoic acid 2-(2-chloroacetyl)hydrazide
  • Benzoic acid, 4-(1,1-dimethylethyl)-, 2-(2-chloroacetyl)hydrazide
  • Benzoic acid, 4-(1,1-dimethylethyl)-, 2-(chloroacetyl)hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.