CAS 874607-03-1

5-(2-Chloro-6-fluorobenzyl)-2H-tetrazole

Description:

5-(2-Chloro-6-fluorobenzyl)-2H-tetrazole is a chemical compound characterized by its tetrazole ring, which is a five-membered aromatic heterocycle containing four nitrogen atoms and one carbon atom. The presence of a 2-chloro-6-fluorobenzyl group enhances its biological activity and solubility properties. This compound is typically a solid at room temperature and may exhibit moderate to high stability under standard conditions. Its structure suggests potential applications in pharmaceuticals, particularly in the development of agents targeting specific biological pathways due to the presence of halogen substituents, which can influence lipophilicity and receptor interactions. The compound's reactivity may be influenced by the electron-withdrawing nature of the chlorine and fluorine atoms, which can affect its behavior in chemical reactions. Additionally, the tetrazole moiety is known for its ability to form coordination complexes with metals, making it of interest in coordination chemistry. Overall, 5-(2-Chloro-6-fluorobenzyl)-2H-tetrazole is a versatile compound with potential applications in medicinal chemistry and materials science.

Formula: C₈H₆ClFN₄

InChI: InChI=1/C8H6ClFN4/c9-6-2-1-3-7(10)5(6)4-8-11-13-14-12-8/h1-3H,4H2,(H,11,12,13,14)

SMILES: c1cc(c(Cc2n[nH]nn2)c(c1)F)Cl

Synonyms:

• 2H-tetrazole, 5-[(2-chloro-6-fluorophenyl)methyl]-
• 5-(2-chloro-6-fluorobenzyl)-1H-tetrazole
• 5-[(2-chloro-6-fluoro-phenyl)methyl]-1H-tetrazole
• 5-[(2-chloro-6-fluorophenyl)methyl]-2h-1,2,3,4-tetrazole

5-[(2-chloro-6-fluorophenyl)methyl]-2H-1,2,3,4-tetrazole

CAS: 874607-03-1

Formula: C₈H₆ClFN₄

Molecular weight: 212.6114

Ref: IN-DA003M3K

5-[(2-chloro-6-fluorophenyl)methyl]-2h-1,2,3,4-tetrazole

CAS: 874607-03-1

Purity: 98%

Molecular weight: 212.6100006

Ref: 10-F644769