CAS 874623-16-2

3-[2-(4-Methoxyphenyl)-4-thiazolyl]-2-propenoic acid

Description:

3-[2-(4-Methoxyphenyl)-4-thiazolyl]-2-propenoic acid, identified by its CAS number 874623-16-2, is an organic compound characterized by its unique structural features. It contains a propenoic acid moiety, which contributes to its reactivity and potential applications in organic synthesis. The presence of a thiazole ring and a methoxy-substituted phenyl group enhances its biological activity and may influence its solubility and stability. This compound is likely to exhibit properties typical of both thiazole derivatives and α,β-unsaturated carboxylic acids, such as potential antimicrobial or anti-inflammatory activities. Its molecular structure suggests that it may participate in various chemical reactions, including Michael additions and condensation reactions, making it of interest in medicinal chemistry and material science. Additionally, the methoxy group can affect the electronic properties of the molecule, potentially enhancing its interaction with biological targets. Overall, this compound represents a class of organic molecules that could be valuable in pharmaceutical development and research.

Formula: C₁₃H₁₁NO₃S

InChI: InChI=1S/C13H11NO3S/c1-17-11-5-2-9(3-6-11)13-14-10(8-18-13)4-7-12(15)16/h2-8H,1H3,(H,15,16)

InChI key: InChIKey=QZWYEYGQIRJQEJ-UHFFFAOYSA-N

SMILES: C(=CC(O)=O)C=1N=C(SC1)C2=CC=C(OC)C=C2

Synonyms:

• 3-[2-(4-Methoxyphenyl)-4-thiazolyl]-2-propenoic acid
• 2-Propenoic acid, 3-[2-(4-methoxyphenyl)-4-thiazolyl]-

(2E)-3-[2-(4-Methoxyphenyl)-1,3-thiazol-4-yl]prop-2-enoic acid

CAS: 874623-16-2

Versatile small molecule scaffold

Formula: C₁₃H₁₁NO₃S

Purity: Min. 95%

Molecular weight: 261.3 g/mol

Ref: 3D-ZJB62316