CymitQuimica logo

CAS 874623-58-2

:

2-Chloro-N-[(5-ethoxy-2,3-dihydro-2-methyl-6-benzofuranyl)methyl]acetamide

Description:
2-Chloro-N-[(5-ethoxy-2,3-dihydro-2-methyl-6-benzofuranyl)methyl]acetamide, with the CAS number 874623-58-2, is a synthetic organic compound characterized by its complex structure, which includes a chloroacetamide moiety and a benzofuran derivative. This compound typically exhibits moderate to high lipophilicity due to the presence of the ethoxy and benzofuran groups, which can influence its solubility and permeability in biological systems. The chloro substituent may impart specific reactivity, making it a potential candidate for various chemical reactions or biological interactions. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where modifications to the benzofuran core can lead to diverse biological activities. Additionally, the presence of the acetamide functional group may enhance its stability and bioavailability. As with many synthetic compounds, understanding its pharmacokinetics, toxicity, and mechanism of action would be essential for evaluating its potential therapeutic uses.
Formula:C14H18ClNO3
InChI:InChI=1S/C14H18ClNO3/c1-3-18-12-5-10-4-9(2)19-13(10)6-11(12)8-16-14(17)7-15/h5-6,9H,3-4,7-8H2,1-2H3,(H,16,17)
InChI key:InChIKey=YTYMCNNUFXKNBY-UHFFFAOYSA-N
SMILES:C(NC(CCl)=O)C=1C=C2C(=CC1OCC)CC(C)O2
Synonyms:
  • 2-Chloro-N-[(5-ethoxy-2,3-dihydro-2-methyl-6-benzofuranyl)methyl]acetamide
  • Acetamide, 2-chloro-N-[(5-ethoxy-2,3-dihydro-2-methyl-6-benzofuranyl)methyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.