CAS 874623-61-7

1,6-Dihydro-6-oxo-1-(2-phenoxyethyl)-3-pyridazinecarboxylic acid

Description:

1,6-Dihydro-6-oxo-1-(2-phenoxyethyl)-3-pyridazinecarboxylic acid is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the phenoxyethyl substituent enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of both the pyridazine and carboxylic acid moieties, which are often associated with bioactive compounds. Additionally, the compound's unique features may allow for interactions with biological targets, making it a candidate for further research in drug discovery. Its CAS number, 874623-61-7, provides a unique identifier for regulatory and safety information, facilitating its study and application in various chemical contexts.

Formula: C₁₃H₁₂N₂O₄

InChI: InChI=1S/C13H12N2O4/c16-12-7-6-11(13(17)18)14-15(12)8-9-19-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,17,18)

InChI key: InChIKey=XRVPEQDXUVOXQJ-UHFFFAOYSA-N

SMILES: C(COC1=CC=CC=C1)N2N=C(C(O)=O)C=CC2=O

Synonyms:

• 1,6-Dihydro-6-oxo-1-(2-phenoxyethyl)-3-pyridazinecarboxylic acid
• 3-Pyridazinecarboxylic acid, 1,6-dihydro-6-oxo-1-(2-phenoxyethyl)-