CAS 874623-62-8

5-(2-Methylcyclopropyl)-2-furanpropanoic acid

Description:

5-(2-Methylcyclopropyl)-2-furanpropanoic acid, with the CAS number 874623-62-8, is an organic compound characterized by its unique structure that includes a furan ring and a cyclopropyl group. This compound features a propanoic acid functional group, which contributes to its acidity and potential reactivity. The presence of the furan ring imparts aromatic characteristics, while the methylcyclopropyl substituent can influence its steric and electronic properties. Typically, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The specific interactions and properties, such as solubility, melting point, and reactivity, would depend on the molecular structure and the functional groups present. Additionally, the compound's behavior in various chemical environments, including its stability and potential for forming derivatives, would be relevant for applications in synthesis and pharmacology. Overall, this compound represents a fascinating intersection of structural complexity and potential utility in various chemical contexts.

Formula: C₁₁H₁₄O₃

InChI: InChI=1S/C11H14O3/c1-7-6-9(7)10-4-2-8(14-10)3-5-11(12)13/h2,4,7,9H,3,5-6H2,1H3,(H,12,13)

InChI key: InChIKey=UGXZHPJNQVWWGB-UHFFFAOYSA-N

SMILES: CC1C(C=2OC(CCC(O)=O)=CC2)C1

Synonyms:

• 2-Furanpropanoic acid, 5-(2-methylcyclopropyl)-
• 5-(2-Methylcyclopropyl)-2-furanpropanoic acid

3-[5-(2-Methylcyclopropyl)furan-2-yl]propanoic acid

CAS: 874623-62-8

Versatile small molecule scaffold

Formula: C₁₁H₁₄O₃

Purity: Min. 95%

Molecular weight: 194.23 g/mol

Ref: 3D-ZJB62362