CymitQuimica logo

CAS 874630-03-2

:

2-{[5-(trifluoromethyl)pyridin-2-yl]amino}ethanol

Description:
2-{[5-(Trifluoromethyl)pyridin-2-yl]amino}ethanol is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a trifluoromethyl group and an aminoethanol moiety. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The aminoethanol part of the molecule introduces a hydroxyl group, which can participate in hydrogen bonding, potentially affecting solubility and reactivity. This compound may exhibit properties typical of both amines and alcohols, such as basicity and the ability to form hydrogen bonds. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. Additionally, the trifluoromethyl group is known to impart metabolic stability and can modulate the pharmacokinetic properties of the compound. Overall, 2-{[5-(trifluoromethyl)pyridin-2-yl]amino}ethanol is a versatile compound with potential implications in various chemical and biological fields.
Formula:C8H9F3N2O
InChI:InChI=1/C8H9F3N2O/c9-8(10,11)6-1-2-7(13-5-6)12-3-4-14/h1-2,5,14H,3-4H2,(H,12,13)
SMILES:c1cc(=NCCO)[nH]cc1C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.