CAS 874676-81-0
:5-Chloro-2-iodopyrimidine
Description:
5-Chloro-2-iodopyrimidine is a heterocyclic organic compound characterized by a pyrimidine ring substituted with chlorine and iodine atoms. The presence of these halogen substituents at the 5 and 2 positions, respectively, contributes to its unique chemical reactivity and properties. This compound typically appears as a solid at room temperature and is soluble in polar organic solvents. It is often utilized in medicinal chemistry and pharmaceutical research due to its potential as a building block for the synthesis of biologically active molecules. The halogen atoms can participate in various chemical reactions, including nucleophilic substitutions and cross-coupling reactions, making it valuable in the development of new drugs and agrochemicals. Additionally, the compound's structure allows for potential interactions with biological targets, which is crucial for its application in drug discovery. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 5-Chloro-2-iodopyrimidine is an important compound in synthetic organic chemistry with diverse applications.
Formula:C4H2ClIN2
InChI:InChI=1S/C4H2ClIN2/c5-3-1-7-4(6)8-2-3/h1-2H
SMILES:c1c(cnc(I)n1)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloro-2-iodopyrimidine
CAS:Formula:C4H2ClIN2Purity:96%Color and Shape:SolidMolecular weight:240.42965-Chloro-2-iodopyrimidine
CAS:5-Chloro-2-iodopyrimidinePurity:97%Color and Shape:PowderMolecular weight:240.43g/mol5-Chloro-2-iodopyrimidine
CAS:<p>5-Chloro-2-iodopyrimidine is an organic molecule that belongs to the class of trifluoromethylated molecules. It was discovered by a team of chemists in 2006 and has been used as a reagent for the efficient trifluoromethylation of organic molecules. 5-Chloro-2-iodopyrimidine can be catalyzed with copper, which is responsible for its unique reactivity. The synthesis of this molecule has been shown to be efficient in organic chemistry.<br>END></p>Formula:C4H2ClIN2Purity:Min. 95%Color and Shape:PowderMolecular weight:240.43 g/mol5-Chloro-2-iodopyrimidine
CAS:Formula:C4H2ClIN2Purity:96%Color and Shape:Solid, White powderMolecular weight:240.43
