CAS 874758-54-0

Ethyl α-hydroxy-6-(methoxymethoxy)-7-[[(trifluoromethyl)sulfonyl]oxy]-1,3-benzodioxole-4-acetate

Description:

Ethyl α-hydroxy-6-(methoxymethoxy)-7-[[(trifluoromethyl)sulfonyl]oxy]-1,3-benzodioxole-4-acetate, with CAS number 874758-54-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzodioxole core. This compound features multiple functional groups, including an ethyl acetate moiety, a hydroxy group, and a trifluoromethyl sulfonate, which contribute to its chemical reactivity and potential applications. The presence of the methoxymethoxy group enhances its solubility and may influence its biological activity. Typically, compounds of this nature are studied for their pharmacological properties, including potential use in medicinal chemistry. The trifluoromethyl group is known to enhance metabolic stability and lipophilicity, which can be advantageous in drug design. Additionally, the compound's unique structure may allow for specific interactions with biological targets, making it of interest in the development of therapeutic agents. As with any chemical substance, safety data and handling precautions should be observed due to the potential hazards associated with its components.

Formula: C₁₄H₁₅F₃O₁₀S

InChI: InChI=1S/C14H15F3O10S/c1-3-23-13(19)9(18)7-4-8(24-5-22-2)11(12-10(7)25-6-26-12)27-28(20,21)14(15,16)17/h4,9,18H,3,5-6H2,1-2H3

InChI key: InChIKey=FKRGLWANGWXCFZ-UHFFFAOYSA-N

SMILES: O(S(C(F)(F)F)(=O)=O)C1=C2C(=C(C(C(OCC)=O)O)C=C1OCOC)OCO2

Synonyms:

• 1,3-Benzodioxole-4-acetic acid, α-hydroxy-6-(methoxymethoxy)-7-[[(trifluoromethyl)sulfonyl]oxy]-, ethyl ester
• Ethyl α-hydroxy-6-(methoxymethoxy)-7-[[(trifluoromethyl)sulfonyl]oxy]-1,3-benzodioxole-4-acetate