CAS 87476-15-1
:5-[2-(ethylsulfanyl)propyl]cyclohexane-1,3-dione
Description:
5-[2-(Ethylsulfanyl)propyl]cyclohexane-1,3-dione, identified by its CAS number 87476-15-1, is an organic compound characterized by a cyclohexane ring substituted with two carbonyl groups (diones) and an ethylsulfanyl group. This compound features a unique structure that includes a cyclohexane backbone, which contributes to its potential for various chemical reactivity and interactions. The presence of the ethylsulfanyl group introduces sulfur into the molecular framework, which can influence the compound's polarity, solubility, and reactivity. The dione functional groups suggest that the compound may participate in reactions typical of diketones, such as nucleophilic additions or condensation reactions. Additionally, the steric and electronic effects of the substituents can affect the compound's stability and reactivity. While specific physical properties such as melting point, boiling point, and solubility are not detailed here, compounds of this nature often exhibit interesting biological and chemical properties, making them of interest in various fields, including medicinal chemistry and materials science.
Formula:C11H18O2S
InChI:InChI=1/C11H18O2S/c1-3-14-8(2)4-9-5-10(12)7-11(13)6-9/h8-9H,3-7H2,1-2H3
SMILES:CCSC(C)CC1CC(=O)CC(=O)C1
Synonyms:- 5-(2-(Ethylthio)propyl)-1,3-cyclohexanedione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-[2-(Ethylthio)propyl]-1,3-cyclohexanedione
CAS:Controlled ProductFormula:C11H18O2SColor and Shape:NeatMolecular weight:214.324
