CymitQuimica logo

CAS 87476-50-4

:

N-{3-[3-(piperidin-1-ylmethyl)phenoxy]propyl}-1,2-benzothiazol-3-amine 1,1-dioxide

Description:
N-{3-[3-(piperidin-1-ylmethyl)phenoxy]propyl}-1,2-benzothiazol-3-amine 1,1-dioxide, identified by its CAS number 87476-50-4, is a chemical compound that features a complex structure incorporating a benzothiazole moiety, a piperidine ring, and a phenoxy group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the benzothiazole group suggests possible interactions with biological targets, making it of interest in drug development. The piperidine ring contributes to its lipophilicity and may enhance its ability to cross biological membranes. Additionally, the amine and sulfone functionalities can participate in hydrogen bonding, influencing solubility and reactivity. Overall, this compound exemplifies the intricate design often seen in pharmaceutical agents, where multiple functional groups are strategically incorporated to optimize efficacy and selectivity in biological systems. Further studies would be necessary to elucidate its specific mechanisms of action and therapeutic potential.
Formula:C22H27N3O3S
InChI:InChI=1/C22H27N3O3S/c26-29(27)21-11-3-2-10-20(21)22(24-29)23-12-7-15-28-19-9-6-8-18(16-19)17-25-13-4-1-5-14-25/h2-3,6,8-11,16H,1,4-5,7,12-15,17H2,(H,23,24)
Synonyms:
  • 1,2-benzisothiazol-3-amine, N-[3-[3-(1-piperidinylmethyl)phenoxy]propyl]-, 1,1-dioxide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.