CymitQuimica logo

CAS 87476-99-1

:

N-{3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl}-1,2-benzothiazol-3-amine 1,1-dioxide

Description:
N-{3-[3-(pyrrolidin-1-ylmethyl)phenoxy]propyl}-1,2-benzothiazol-3-amine 1,1-dioxide, with CAS number 87476-99-1, is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety and a pyrrolidine group. This compound typically exhibits properties associated with both amines and aromatic compounds, such as potential solubility in organic solvents and moderate stability under standard conditions. The presence of the benzothiazole ring suggests potential biological activity, as many benzothiazole derivatives are known for their pharmacological properties. The pyrrolidine group may contribute to the compound's ability to interact with biological targets, possibly influencing its pharmacokinetics and dynamics. Additionally, the 1,1-dioxide functional group can enhance the compound's reactivity and solubility. Overall, this compound may be of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents. However, specific characteristics such as melting point, boiling point, and spectral data would require experimental determination or literature reference for precise values.
Formula:C21H25N3O3S
InChI:InChI=1/C21H25N3O3S/c25-28(26)20-10-2-1-9-19(20)21(23-28)22-11-6-14-27-18-8-5-7-17(15-18)16-24-12-3-4-13-24/h1-2,5,7-10,15H,3-4,6,11-14,16H2,(H,22,23)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.