CymitQuimica logo

CAS 874765-99-8

:

4-(1H-Tetrazol-5-ylmethyl)-2H-1,4-benzothiazin-3(4H)-one

Description:
4-(1H-Tetrazol-5-ylmethyl)-2H-1,4-benzothiazin-3(4H)-one is a chemical compound characterized by its unique structural features, which include a benzothiazine core and a tetrazole moiety. This compound typically exhibits properties such as moderate solubility in polar solvents and potential bioactivity, making it of interest in pharmaceutical research. The presence of the tetrazole group may contribute to its ability to form hydrogen bonds, enhancing its interactions with biological targets. Additionally, the benzothiazine structure is known for its diverse pharmacological activities, including antimicrobial and anti-inflammatory effects. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, which could be leveraged in synthetic applications. Overall, 4-(1H-Tetrazol-5-ylmethyl)-2H-1,4-benzothiazin-3(4H)-one represents a promising candidate for further investigation in medicinal chemistry and drug development.
Formula:C10H9N5OS
InChI:InChI=1/C10H9N5OS/c16-10-6-17-8-4-2-1-3-7(8)15(10)5-9-11-13-14-12-9/h1-4H,5-6H2,(H,11,12,13,14)
SMILES:c1ccc2c(c1)N(Cc1n[nH]nn1)C(=O)CS2
Synonyms:
  • 2H-1,4-benzothiazin-3(4H)-one, 4-(1H-tetrazol-5-ylmethyl)-
  • 4-(1H-tetrazol-5-ylmethyl)-1,4-benzothiazin-3-one
  • 4-(1H-tetrazol-5-ylmethyl)-2H-1,4-benzothiazin-3(4H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.