CAS 874772-70-0
:3-(2-Thienyl)-4-cinnolinecarboxylic acid
Description:
3-(2-Thienyl)-4-cinnolinecarboxylic acid is an organic compound characterized by its unique structure, which includes a thienyl group and a cinnoline moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential reactivity and biological activity. The presence of the thienyl group introduces sulfur into the structure, which can influence its electronic properties and solubility. The carboxylic acid functional group is known for its acidity and ability to form hydrogen bonds, which can enhance the compound's interactions in biological systems. Additionally, the compound may exhibit fluorescence or other photophysical properties due to its conjugated system. Its potential applications could span various fields, including pharmaceuticals, where it may serve as a scaffold for drug development or as a probe in biochemical assays. However, specific characteristics such as melting point, solubility, and spectral data would require empirical measurement or literature reference for precise details.
Formula:C13H8N2O2S
InChI:InChI=1S/C13H8N2O2S/c16-13(17)11-8-4-1-2-5-9(8)14-15-12(11)10-6-3-7-18-10/h1-7H,(H,16,17)
InChI key:InChIKey=QLSLVBSTFKGJQR-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(N=NC2=C1C=CC=C2)C3=CC=CS3
Synonyms:- 3-(2-Thienyl)-4-cinnolinecarboxylic acid
- 4-Cinnolinecarboxylic acid, 3-(2-thienyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.