CAS 874774-43-3

6-(Ethylsulfonyl)-2H-1,4-benzoxazin-3(4H)-one

Description:

6-(Ethylsulfonyl)-2H-1,4-benzoxazin-3(4H)-one, with the CAS number 874774-43-3, is a chemical compound characterized by its unique structure that includes a benzoxazine ring fused with a sulfonyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups that can participate in various chemical reactions. The ethylsulfonyl moiety may impart specific polar characteristics, influencing its interactions in biological systems or chemical environments. Additionally, compounds of this class are often studied for their potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. The presence of the benzoxazine structure suggests potential for diverse biological activity, making it a subject of interest in medicinal chemistry. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the specific characteristics can vary based on purity and formulation.

Formula: C₁₀H₁₁NO₄S

InChI: InChI=1S/C10H11NO4S/c1-2-16(13,14)7-3-4-9-8(5-7)11-10(12)6-15-9/h3-5H,2,6H2,1H3,(H,11,12)

InChI key: InChIKey=CLBHSYOAMTZTBM-UHFFFAOYSA-N

SMILES: S(CC)(=O)(=O)C=1C=C2C(=CC1)OCC(=O)N2

Synonyms:

• 2H-1,4-Benzoxazin-3(4H)-one, 6-(ethylsulfonyl)-
• 6-(Ethylsulfonyl)-2H-1,4-benzoxazin-3(4H)-one

6-(Ethylsulphonyl)-2H-1,4-benzoxazin-3(4H)-one

CAS: 874774-43-3

6-(Ethylsulphonyl)-2H-1,4-benzoxazin-3(4H)-one

Formula: C₁₀H₁₁NO₄S

Purity: 97% (Typical Value in Batch COA)

Color and Shape: off-white powder crystals

Molecular weight: 241.26g/mol

Ref: 54-OR9456

6-(Ethylsulfonyl)-2H-benzo[b][1,4]oxazin-3(4H)-one

CAS: 874774-43-3

Purity: 98%

Molecular weight: 241.2599945

Ref: 10-F721974