CAS 874774-45-5
:2,3-Dihydro-7-methyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid
Description:
2,3-Dihydro-7-methyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid, identified by its CAS number 874774-45-5, is a chemical compound that belongs to the class of benzoxazines, which are heterocyclic compounds featuring a benzene ring fused to an oxazine ring. This compound typically exhibits a range of characteristics, including a specific molecular structure that contributes to its potential biological activity. It may possess functional groups such as carboxylic acids and carbonyls, which can influence its reactivity and solubility in various solvents. The presence of the methyl group suggests that it may have unique steric and electronic properties, potentially affecting its interactions in biological systems. Additionally, compounds in this class are often studied for their pharmacological properties, including anti-inflammatory and antimicrobial activities. However, detailed studies on its specific properties, such as melting point, boiling point, and spectral data, would be necessary to fully characterize its behavior and applications in various fields, including medicinal chemistry and materials science.
Formula:C11H11NO4
InChI:InChI=1S/C11H11NO4/c1-7-2-3-8-9(4-7)16-6-10(13)12(8)5-11(14)15/h2-4H,5-6H2,1H3,(H,14,15)
InChI key:InChIKey=WLRZYFYHWHXLJB-UHFFFAOYSA-N
SMILES:C(C(O)=O)N1C=2C(OCC1=O)=CC(C)=CC2
Synonyms:- 2,3-Dihydro-7-methyl-3-oxo-4H-1,4-benzoxazine-4-acetic acid
- 4H-1,4-Benzoxazine-4-acetic acid, 2,3-dihydro-7-methyl-3-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.