CymitQuimica logo

CAS 874781-04-1

:

4-chloro-5,8-difluoro-quinoline

Description:
4-Chloro-5,8-difluoro-quinoline is a heterocyclic organic compound characterized by a quinoline backbone, which consists of a fused benzene and pyridine ring. The presence of chlorine and fluorine substituents at specific positions on the quinoline structure significantly influences its chemical properties and reactivity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of antimicrobial or anticancer agents, due to the biological activity often associated with fluorinated heterocycles. The chlorine and fluorine atoms can enhance lipophilicity and metabolic stability, making such compounds of interest in medicinal chemistry. Additionally, the compound may undergo various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, which can be exploited in synthetic pathways. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks. Overall, 4-chloro-5,8-difluoro-quinoline represents a valuable compound in both research and industrial applications.
Formula:C9H4ClF2N
InChI:InChI=1/C9H4ClF2N/c10-5-3-4-13-9-7(12)2-1-6(11)8(5)9/h1-4H
SMILES:c1cc(c2c(c(ccn2)Cl)c1F)F
Synonyms:
  • 4-Chloro-5,8-difluoroquinoline
  • Quinoline, 4-Chloro-5,8-Difluoro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.