CymitQuimica logo

CAS 87480-43-1

:

hexacyclo[6.6.1.1~3,6~.1~10,13~.0~2,7~.0~9,14~]heptadec-4-ene (non-preferred name)

Description:
Hexacyclo[6.6.1.1^3,6^1^10,13^0^2,7^0^9,14^]heptadec-4-ene, with the CAS number 87480-43-1, is a polycyclic hydrocarbon characterized by its complex structure comprising multiple interconnected cycloalkane rings. This compound features a unique arrangement of carbon atoms that contributes to its stability and potential reactivity. Typically, such polycyclic compounds exhibit interesting physical properties, including a relatively high melting and boiling point due to the strong van der Waals forces between the rings. The presence of double bonds in the structure suggests potential for reactivity, particularly in addition reactions. Additionally, hexacyclo compounds often display unique optical and electronic properties, making them of interest in materials science and organic electronics. However, due to the complexity of its structure, the synthesis and characterization of this compound can be challenging. Its applications may extend to fields such as organic synthesis, polymer chemistry, and potentially in the development of novel materials. Further research is necessary to fully explore its properties and potential uses.
Formula:C17H22
InChI:InChI=1/C17H22/c1-2-9-5-8(1)14-12-7-13(15(9)14)17-11-4-3-10(6-11)16(12)17/h1-2,8-17H,3-7H2
SMILES:C1=CC2CC1C1C3CC(C21)C1C2CCC(C2)C31
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.