
CAS 874801-53-3
:5-Chloro-2-fluoro-4-methylbenzenesulfonyl chloride
Description:
5-Chloro-2-fluoro-4-methylbenzenesulfonyl chloride, with the CAS number 874801-53-3, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a substituted aromatic ring. This compound features a chlorine atom and a fluorine atom on the benzene ring, along with a methyl group, which influences its reactivity and solubility. The sulfonyl chloride group is known for its high reactivity, particularly in nucleophilic substitution reactions, making this compound useful in various synthetic applications, including the preparation of sulfonamides and other derivatives. It is typically a colorless to pale yellow liquid or solid, depending on its form, and is sensitive to moisture, which can lead to hydrolysis. Safety precautions are necessary when handling this compound, as it can be corrosive and may cause irritation to the skin, eyes, and respiratory system. Proper storage in a cool, dry place, away from moisture and incompatible substances, is essential to maintain its stability and reactivity.
Formula:C7H5Cl2FO2S
InChI:InChI=1S/C7H5Cl2FO2S/c1-4-2-6(10)7(3-5(4)8)13(9,11)12/h2-3H,1H3
InChI key:InChIKey=POMYQSJCYNGSIW-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(F)C=C(C)C(Cl)=C1
Synonyms:- 5-Chloro-2-fluoro-4-methylbenzenesulfonyl chloride
- Benzenesulfonyl chloride, 5-chloro-2-fluoro-4-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.