CAS 874801-65-7

Methyl 4-[(1,1-dimethylethoxy)carbonyl]hexahydro-1H-1,4-diazepine-1-propanoate

Description:

Methyl 4-[(1,1-dimethylethoxy)carbonyl]hexahydro-1H-1,4-diazepine-1-propanoate is a chemical compound characterized by its complex structure, which includes a hexahydro-1H-1,4-diazepine ring. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of the 1,1-dimethylethoxycarbonyl group enhances its stability and may influence its biological activity. Typically, compounds of this nature are of interest in medicinal chemistry due to their potential pharmacological properties. They may exhibit various activities, including anti-inflammatory or analgesic effects, depending on their specific interactions with biological targets. The compound's molecular structure suggests it may be lipophilic, which can affect its absorption and distribution in biological systems. Additionally, the presence of multiple functional groups indicates potential for further chemical modifications, making it a versatile candidate for drug development. As with many organic compounds, safety and handling precautions should be observed, as the toxicity and environmental impact of such substances can vary.

Formula: C₁₄H₂₆N₂O₄

InChI: InChI=1S/C14H26N2O4/c1-14(2,3)20-13(18)16-8-5-7-15(10-11-16)9-6-12(17)19-4/h5-11H2,1-4H3

InChI key: InChIKey=SRZLAHPSBSPHPW-UHFFFAOYSA-N

SMILES: C(OC(C)(C)C)(=O)N1CCN(CCC(OC)=O)CCC1

Synonyms:

• 1H-1,4-Diazepine-1-propanoic acid, 4-[(1,1-dimethylethoxy)carbonyl]hexahydro-, methyl ester
• tert-Butyl 4-(3-methoxy-3-oxopropyl)-1,4-diazepane-1-carboxylate
• Methyl 4-[(1,1-dimethylethoxy)carbonyl]hexahydro-1H-1,4-diazepine-1-propanoate

tert-Butyl 4-(3-methoxy-3-oxopropyl)homopiperazine-1-carboxylate

CAS: 874801-65-7

tert-Butyl 4-(3-methoxy-3-oxopropyl)homopiperazine-1-carboxylate

Purity: ≥95%

Molecular weight: 286.37g/mol

Ref: 54-OR110608