CymitQuimica logo

CAS 874801-71-5

:

2-(1,4-diazepan-1-yl)-N,N-diethylethanamine

Description:
2-(1,4-diazepan-1-yl)-N,N-diethylethanamine, with the CAS number 874801-71-5, is a chemical compound characterized by its unique structure that includes a diazepane ring and a diethylamino group. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of nitrogen atoms. The diazepane moiety contributes to its potential biological activity, as compounds containing diazepane rings are often explored for their pharmacological properties. The presence of two ethyl groups attached to the nitrogen atoms enhances its lipophilicity, which may influence its solubility in organic solvents and biological membranes. Additionally, the compound may exhibit moderate to high stability under standard conditions, although specific reactivity can depend on the surrounding environment and functional groups present. Overall, this compound's structural features suggest potential applications in medicinal chemistry and drug development, particularly in the design of agents targeting the central nervous system.
Formula:C11H25N3
InChI:InChI=1/C11H25N3/c1-3-13(4-2)10-11-14-8-5-6-12-7-9-14/h12H,3-11H2,1-2H3
Synonyms:
  • 1H-1,4-diazepine-1-ethanamine, N,N-diethylhexahydro-
  • 2-(1,4-Diazepan-1-yl)-N,N-diethylethanamine
  • N-[2-(1,4-Diazepan-1-yl)ethyl]-N,N-diethylamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.