CAS 874804-03-2
:2-[2-(trifluoromethyl)phenoxy]thioacetamide
Description:
2-[2-(Trifluoromethyl)phenoxy]thioacetamide is a chemical compound characterized by its unique structural features, which include a thioacetamide functional group and a trifluoromethyl-substituted phenoxy moiety. The presence of the trifluoromethyl group enhances the compound's lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The thioacetamide group contributes to the compound's reactivity, particularly in nucleophilic substitution reactions. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in agrochemicals or medicinal chemistry, particularly in the development of novel compounds with specific biological activities. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks. As with any chemical, thorough characterization through techniques such as NMR, IR spectroscopy, and mass spectrometry is essential for confirming its identity and purity.
Formula:C9H8F3NOS
InChI:InChI=1/C9H8F3NOS/c10-9(11,12)6-3-1-2-4-7(6)14-5-8(13)15/h1-4H,5H2,(H2,13,15)
SMILES:c1ccc(c(c1)C(F)(F)F)OCC(=N)S
Synonyms:- 2-[2-(Trifluoromethyl)phenoxy]ethanethioamide
- Ethanethioamide, 2-[2-(Trifluoromethyl)Phenoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
