CAS 874804-04-3

2-(2-Bromo-5-fluorophenoxy)acetic acid

Description:

2-(2-Bromo-5-fluorophenoxy)acetic acid is an organic compound characterized by its unique structure, which includes a phenoxy group substituted with bromine and fluorine atoms. This compound features a carboxylic acid functional group, contributing to its acidic properties. The presence of the bromine and fluorine substituents on the aromatic ring can influence its reactivity, solubility, and biological activity. Typically, compounds like this may exhibit herbicidal or pharmaceutical properties, making them of interest in agricultural and medicinal chemistry. The molecular structure allows for potential interactions with biological systems, which can be explored for various applications. Additionally, the compound's solubility in organic solvents and water can vary, affecting its use in formulations. Safety data should be consulted to understand its handling and toxicity, as halogenated compounds can sometimes pose environmental and health risks. Overall, 2-(2-Bromo-5-fluorophenoxy)acetic acid represents a class of compounds with diverse applications due to their functional groups and substituents.

Formula: C₈H₆BrFO₃

InChI: InChI=1S/C8H6BrFO3/c9-6-2-1-5(10)3-7(6)13-4-8(11)12/h1-3H,4H2,(H,11,12)

InChI key: InChIKey=LDKGNTPFIVWMGO-UHFFFAOYSA-N

SMILES: O(CC(O)=O)C1=C(Br)C=CC(F)=C1

Synonyms:

• Acetic acid, 2-(2-bromo-5-fluorophenoxy)-
• Acetic acid, (2-bromo-5-fluorophenoxy)-
• 2-(2-Bromo-5-fluorophenoxy)acetic acid

(2-Bromo-5-fluorophenoxy)acetic acid

CAS: 874804-04-3

(2-Bromo-5-fluorophenoxy)acetic acid

Purity: 95%

Molecular weight: 249.03g/mol

Ref: 54-PC109357