CAS 874811-05-9

Benzene, 1,2-dimethyl-4-[1-(3-methylphenyl)ethyl]-

Description:

Benzene, 1,2-dimethyl-4-[1-(3-methylphenyl)ethyl]- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with multiple alkyl groups. The presence of two methyl groups at the 1 and 2 positions of the benzene ring, along with a 1-(3-methylphenyl)ethyl substituent at the 4 position, contributes to its complex molecular architecture. This compound is likely to exhibit hydrophobic properties due to its non-polar nature, making it less soluble in water but soluble in organic solvents. Its structure suggests potential applications in organic synthesis and materials science, as well as in the development of fragrances or flavoring agents, given the presence of aromatic groups. Additionally, the compound may exhibit interesting chemical reactivity typical of substituted benzenes, such as electrophilic aromatic substitution. Safety and handling considerations should be taken into account, as many aromatic compounds can be hazardous. Overall, this compound exemplifies the diversity of substituted aromatic hydrocarbons in organic chemistry.

Formula: C₁₇H₂₀

InChI: InChI=1S/C17H20/c1-12-6-5-7-16(10-12)15(4)17-9-8-13(2)14(3)11-17/h5-11,15H,1-4H3

InChI key: LZSTVXQZHVVAOE-UHFFFAOYSA-N

SMILES: CC1=CC(=CC=C1)C(C)C2=CC(=C(C=C2)C)C