CymitQuimica logo

CAS 874821-50-8

:

[5-chloro-2-(trifluoromethoxy)phenyl]methanamine

Description:
[5-chloro-2-(trifluoromethoxy)phenyl]methanamine, with the CAS number 874821-50-8, is a chemical compound characterized by its unique structural features. It contains a phenyl ring substituted with a chlorine atom and a trifluoromethoxy group, which significantly influences its chemical reactivity and physical properties. The presence of the amino group (methanamine) suggests that it can participate in various chemical reactions, including nucleophilic substitutions and hydrogen bonding. This compound is likely to exhibit polar characteristics due to the electronegative fluorine atoms and the amino group, which can affect its solubility in different solvents. Additionally, the trifluoromethoxy group may impart unique electronic properties, making it of interest in medicinal chemistry and material science. Its potential applications could include use as an intermediate in the synthesis of pharmaceuticals or agrochemicals. However, specific safety and handling guidelines should be followed, as with any chemical substance, to mitigate risks associated with its use.
Formula:C8H7ClF3NO
InChI:InChI=1/C8H7ClF3NO/c9-6-1-2-7(5(3-6)4-13)14-8(10,11)12/h1-3H,4,13H2
SMILES:c1cc(c(cc1Cl)CN)OC(F)(F)F
Synonyms:
  • 5-Chloro-2-(trifluoromethoxy)benzylamine
  • Z1R Cg Foxfff
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.