CymitQuimica logo

CAS 874821-67-7

:

4-Oxazolemethanol, 5-methyl-

Description:
4-Oxazolemethanol, 5-methyl- is a chemical compound characterized by its oxazole ring structure, which is a five-membered heterocyclic compound containing both nitrogen and oxygen atoms. This compound features a hydroxymethyl group (-CH2OH) and a methyl group (-CH3) attached to the oxazole ring, contributing to its unique properties. It is typically a colorless to pale yellow liquid or solid, depending on its state at room temperature. The presence of the hydroxymethyl group suggests potential for hydrogen bonding, which may influence its solubility in polar solvents. Additionally, the methyl group can affect the compound's reactivity and stability. 4-Oxazolemethanol, 5-methyl- may have applications in pharmaceuticals or as an intermediate in organic synthesis due to its functional groups. However, specific information regarding its biological activity, toxicity, and environmental impact would require further investigation and data from safety profiles or research studies.
Formula:C5H7NO2
InChI:InChI=1S/C5H7NO2/c1-4-5(2-7)6-3-8-4/h3,7H,2H2,1H3
InChI key:FKQJNZYJRXRLNZ-UHFFFAOYSA-N
SMILES:CC1=C(N=CO1)CO
Found 5 products.