CAS 874830-60-1
:6-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acid
Description:
6-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acid is a heterocyclic compound characterized by its imidazo-pyridine structure, which incorporates both a chlorine atom and a trifluoromethyl group. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry. The chlorine atom may also affect the compound's electronic properties and steric hindrance. Typically, such compounds are evaluated for their pharmacological properties, including antimicrobial or anticancer activities. The molecular structure allows for various interactions with biological targets, which can be explored in drug development. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the imidazo and pyridine rings, making it a subject of interest in synthetic and medicinal chemistry research.
Formula:C9H4ClF3N2O2
InChI:InChI=1S/C9H4ClF3N2O2/c10-4-1-2-5-14-7(9(11,12)13)6(8(16)17)15(5)3-4/h1-3H,(H,16,17)
InChI key:InChIKey=NJBXNXQRWKNKLV-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1N2C(=NC1C(F)(F)F)C=CC(Cl)=C2
Synonyms:- 6-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acid
- Imidazo[1,2-a]pyridine-3-carboxylic acid, 6-chloro-2-(trifluoromethyl)-
- BUTTPARK 87\01-87
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acid
CAS:6-Chloro-2-(trifluoromethyl)imidazo[1,2-a]pyridine-3-carboxylic acidPurity:techMolecular weight:264.59g/mol
