CAS 874830-75-8: 5-Bromo-7-fluoro-1H-indole-2,3-dione

Description:5-Bromo-7-fluoro-1H-indole-2,3-dione is a synthetic organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a bromine atom at the 5-position and a fluorine atom at the 7-position of the indole ring, contributing to its unique reactivity and potential biological activity. The presence of the dione functional groups at the 2 and 3 positions indicates that it contains two carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure allows for potential interactions with biological targets, and it may be explored for applications in drug development. As with many halogenated compounds, it is essential to consider its environmental impact and toxicity profile during research and application.

Formula:C₈H₃BrFNO₂

InChI:InChI=1S/C8H3BrFNO2/c9-3-1-4-6(5(10)2-3)11-8(13)7(4)12/h1-2H,(H,11,12,13)

InChI key:InChIKey=YLDKCLPACIIYJC-UHFFFAOYSA-N

SMILES:O=C1NC=2C(F)=CC(Br)=CC2C1=O