CAS 874831-37-5
:(4-Aminophenyl)-4-thiomorpholinylmethanone
Description:
(4-Aminophenyl)-4-thiomorpholinylmethanone, identified by its CAS number 874831-37-5, is a chemical compound that features a thiomorpholine ring and an amine group attached to a phenyl ring. This compound typically exhibits characteristics common to amides and thiomorpholines, such as moderate solubility in polar solvents and potential reactivity due to the presence of the amine and carbonyl functional groups. The thiomorpholine moiety may impart unique properties, including potential biological activity, making it of interest in medicinal chemistry. The compound's structure suggests it may participate in hydrogen bonding, influencing its interactions with biological targets. Additionally, the presence of the amino group can enhance its reactivity and solubility in various chemical environments. Overall, (4-Aminophenyl)-4-thiomorpholinylmethanone is a compound that may have applications in pharmaceuticals or as a building block in organic synthesis, although specific applications would depend on further research into its biological activity and chemical behavior.
Formula:C11H14N2OS
InChI:InChI=1S/C11H14N2OS/c12-10-3-1-9(2-4-10)11(14)13-5-7-15-8-6-13/h1-4H,5-8,12H2
InChI key:InChIKey=GJDBUOPLZVNRRN-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(N)C=C1)N2CCSCC2
Synonyms:- Thiomorpholine, 4-(4-aminobenzoyl)-
- Methanone, (4-aminophenyl)-4-thiomorpholinyl-
- 4-(4-Aminobenzoyl)thiomorpholine
- (4-Aminophenyl)-4-thiomorpholinylmethanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
4-(4-Aminobenzoyl)thiomorpholine
CAS:Controlled ProductFormula:C11H14N2O4SColor and Shape:NeatMolecular weight:222.31
