CAS 874841-12-0

3-(Aminosulfonyl)-2,6-dimethoxybenzoic acid

Description:

3-(Aminosulfonyl)-2,6-dimethoxybenzoic acid, identified by its CAS number 874841-12-0, is a chemical compound characterized by the presence of a benzoic acid core substituted with two methoxy groups and an aminosulfonyl group. This compound typically exhibits properties associated with both aromatic compounds and sulfonamides, including potential solubility in polar solvents due to the presence of the sulfonamide functional group. The methoxy groups contribute to its electron-donating characteristics, which can influence its reactivity and interaction with biological targets. The aminosulfonyl group may impart specific biological activities, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Additionally, the compound's structure suggests potential for hydrogen bonding and other intermolecular interactions, which can affect its physical properties such as melting point and solubility. Overall, 3-(Aminosulfonyl)-2,6-dimethoxybenzoic acid represents a unique scaffold for further exploration in medicinal chemistry and related fields.

Formula: C₉H₁₁NO₆S

InChI: InChI=1S/C9H11NO6S/c1-15-5-3-4-6(17(10,13)14)8(16-2)7(5)9(11)12/h3-4H,1-2H3,(H,11,12)(H2,10,13,14)

InChI key: InChIKey=CORYOSUAETTXGO-UHFFFAOYSA-N

SMILES: O(C)C1=C(C(O)=O)C(OC)=CC=C1S(N)(=O)=O

Synonyms:

• 3-(Aminosulfonyl)-2,6-dimethoxybenzoic acid
• Benzoic acid, 3-(aminosulfonyl)-2,6-dimethoxy-

2,6-Dimethoxy-3-sulfamoylbenzoic acid

CAS: 874841-12-0

Versatile small molecule scaffold

Formula: C₉H₁₁NO₆S

Purity: Min. 95%

Molecular weight: 261.25 g/mol

Ref: 3D-ZJB84112