CymitQuimica logo

CAS 87486-29-1

:

7-methoxy-1,2-dimethyl-3,4-dioxo-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile

Description:
7-Methoxy-1,2-dimethyl-3,4-dioxo-1,2,3,4-tetrahydroisoquinoline-1-carbonitrile, identified by its CAS number 87486-29-1, is a chemical compound that belongs to the isoquinoline family. This compound features a tetrahydroisoquinoline core, which is characterized by a bicyclic structure containing a nitrogen atom. The presence of methoxy and dimethyl groups contributes to its unique chemical properties, influencing its reactivity and potential biological activity. The dioxo functional groups indicate the presence of two carbonyl (C=O) groups, which can participate in various chemical reactions, including nucleophilic attacks. The carbonitrile group (-C≡N) adds to the compound's polarity and can enhance its solubility in polar solvents. Overall, this compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural complexity and functional groups suggest potential applications in various fields, including organic synthesis and pharmaceuticals. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C13H12N2O3
InChI:InChI=1/C13H12N2O3/c1-13(7-14)10-6-8(18-3)4-5-9(10)11(16)12(17)15(13)2/h4-6H,1-3H3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.