CymitQuimica logo

CAS 87486-33-7

:

2(1H)-Pyrazinone, 3,5-dichloro-1-methyl-

Description:
2(1H)-Pyrazinone, 3,5-dichloro-1-methyl- is an organic compound characterized by its pyrazinone structure, which features a pyrazine ring with a carbonyl group and a methyl substituent. The presence of two chlorine atoms at the 3 and 5 positions of the ring contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its molecular structure suggests potential applications in pharmaceuticals or agrochemicals, as halogenated compounds often display enhanced biological activity. The compound's CAS number, 87486-33-7, allows for precise identification and retrieval of information regarding its synthesis, safety data, and regulatory status. As with many halogenated organic compounds, it is essential to handle this substance with care due to potential toxicity and environmental impact. Proper safety measures should be observed when working with it in laboratory or industrial settings.
Formula:C5H4Cl2N2O
InChI:InChI=1S/C5H4Cl2N2O/c1-9-2-3(6)8-4(7)5(9)10/h2H,1H3
InChI key:QHMYGZJTKUTEAB-UHFFFAOYSA-N
SMILES:CN1C=C(N=C(C1=O)Cl)Cl
Found 5 products.