CAS 874888-70-7

2H-Pyran-4-amine, tetrahydro-N-methyl-N-[2-(4-nitrophenyl)ethyl]-

Description:

2H-Pyran-4-amine, tetrahydro-N-methyl-N-[2-(4-nitrophenyl)ethyl]- is a chemical compound characterized by its unique structure, which includes a pyran ring and an amine functional group. The presence of the tetrahydro group indicates that the compound is saturated, contributing to its stability and reactivity. The N-methyl and N-[2-(4-nitrophenyl)ethyl] substituents suggest that this compound may exhibit interesting pharmacological properties, potentially influencing its interactions with biological targets. The nitrophenyl group can enhance the compound's lipophilicity and may play a role in its biological activity. This compound is likely to be soluble in organic solvents, and its reactivity may be influenced by the functional groups present. As with many nitrogen-containing heterocycles, it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic additions. Overall, the characteristics of this compound make it a subject of interest in medicinal chemistry and drug development, although specific biological activity and applications would require further investigation.

Formula: C₁₄H₂₀N₂O₃

InChI: InChI=1S/C14H20N2O3/c1-15(13-7-10-19-11-8-13)9-6-12-2-4-14(5-3-12)16(17)18/h2-5,13H,6-11H2,1H3

InChI key: NLALBSMEFQYPOL-UHFFFAOYSA-N

SMILES: CN(CCC1=CC=C(C=C1)[N+](=O)[O-])C2CCOCC2