CAS 874899-05-5
:tert-butyl N-[(1S)-2-methyl-1-[[3-methyl-1-(phenylcarbamoyl)butyl]carbamoyl]propyl]carbamate
Description:
Tert-butyl N-[(1S)-2-methyl-1-[[3-methyl-1-(phenylcarbamoyl)butyl]carbamoyl]propyl]carbamate, identified by its CAS number 874899-05-5, is a synthetic organic compound characterized by its complex structure, which includes multiple functional groups such as carbamate and amide linkages. This compound typically exhibits properties associated with carbamates, including moderate solubility in organic solvents and potential stability under various conditions. Its molecular structure suggests it may participate in hydrogen bonding due to the presence of amide groups, influencing its reactivity and interactions with biological systems. The tert-butyl group contributes to steric hindrance, which can affect the compound's biological activity and pharmacokinetics. Such compounds are often studied for their potential applications in medicinal chemistry, particularly in drug design, due to their ability to modulate biological pathways. However, specific characteristics such as melting point, boiling point, and spectral data would require empirical measurement or literature reference for precise values.
Formula:C22H35N3O4
InChI:InChI=1/C22H35N3O4/c1-14(2)13-17(19(26)23-16-11-9-8-10-12-16)24-20(27)18(15(3)4)25-21(28)29-22(5,6)7/h8-12,14-15,17-18H,13H2,1-7H3,(H,23,26)(H,24,27)(H,25,28)/t17?,18-/m0/s1
SMILES:CC(C)CC(C(=Nc1ccccc1)O)N=C([C@H](C(C)C)N=C(O)OC(C)(C)C)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
N-Boc-L-valinyl-L-leucinyl Anilide
CAS:Formula:C22H35N3O4Color and Shape:SolidMolecular weight:405.531N-Boc-L-valinyl-L-leucinyl Anilide
CAS:Controlled Product<p>Applications N-Boc-L-valinyl-L-leucinyl Anilide (cas# 874899-05-5) is a compound useful in organic synthesis.<br></p>Formula:C22H35N3O4Color and Shape:NeatMolecular weight:405.53


