CymitQuimica logo

CAS 874908-12-0

:

2-ethoxy-4-[2-[[1-[2-[(5-hydroxy-5-oxo-pentyl)amino]phenyl]-3-methyl-butyl]amino]-2-oxo-ethyl]benzoic acid

Description:
2-Ethoxy-4-[2-[[1-[2-[(5-hydroxy-5-oxo-pentyl)amino]phenyl]-3-methyl-butyl]amino]-2-oxo-ethyl]benzoic acid, with CAS number 874908-12-0, is a complex organic compound characterized by its multi-functional structure. It features an ethoxy group, which enhances its solubility in organic solvents, and a benzoic acid moiety that contributes to its acidity and potential for forming salts. The presence of multiple amine and carbonyl groups suggests that it may engage in hydrogen bonding, influencing its reactivity and interaction with biological systems. The compound's structure indicates potential applications in medicinal chemistry, possibly as a pharmaceutical agent, due to its intricate arrangement of functional groups that may interact with biological targets. Additionally, the presence of a hydroxy group may enhance its solubility and bioavailability. Overall, this compound's unique characteristics make it a subject of interest for further research in drug development and related fields.
Formula:C27H36N2O6
InChI:InChI=1/C27H36N2O6/c1-4-35-24-16-19(12-13-21(24)27(33)34)17-25(30)29-23(15-18(2)3)20-9-5-6-10-22(20)28-14-8-7-11-26(31)32/h5-6,9-10,12-13,16,18,23,28H,4,7-8,11,14-15,17H2,1-3H3,(H,29,30)(H,31,32)(H,33,34)
SMILES:CCOc1cc(ccc1C(=O)O)CC(=NC(CC(C)C)c1ccccc1NCCCCC(=O)O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.