CymitQuimica logo

CAS 87492-65-7

:

3,3-Difluoro-2-methylalanine methyl ester

Description:
3,3-Difluoro-2-methylalanine methyl ester is an amino acid derivative characterized by the presence of two fluorine atoms at the 3-position of the alanine backbone, along with a methyl group at the 2-position and a methyl ester functional group. This compound is notable for its potential applications in medicinal chemistry and as a building block in peptide synthesis due to the presence of the amino and ester functional groups. The fluorine substituents can influence the compound's biological activity and lipophilicity, making it of interest in drug design. The methyl ester group enhances the compound's solubility and stability, which can be advantageous in various chemical reactions and biological applications. Additionally, the presence of fluorine can affect the compound's reactivity and interaction with biological targets. Overall, 3,3-Difluoro-2-methylalanine methyl ester is a versatile compound with unique properties that can be leveraged in synthetic and pharmaceutical chemistry.
Formula:C5H9F2NO2
InChI:InChI=1S/C5H9F2NO2/c1-5(8,3(6)7)4(9)10-2/h3H,8H2,1-2H3
InChI key:InChIKey=NBWQGKYKXCGCOG-UHFFFAOYSA-N
SMILES:C(C(OC)=O)(C(F)F)(C)N
Synonyms:
  • Alanine, 3,3-difluoro-2-methyl-, methyl ester (9CI)
  • 3,3-Difluoro-2-methylalanine methyl ester
  • Alanine, 3,3-difluoro-2-methyl-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.