CAS 87494-16-4
:L-alanyl-L-serylglycine
Description:
L-alanyl-L-serylglycine, with the CAS number 87494-16-4, is a dipeptide composed of the amino acids L-alanine, L-serine, and glycine. This compound features a combination of both hydrophobic and hydrophilic properties due to the presence of the non-polar alanine and the polar serine and glycine residues. It is typically characterized by its role in biological systems, particularly in protein synthesis and as a potential signaling molecule. The peptide bonds in L-alanyl-L-serylglycine contribute to its stability and functionality in various biochemical processes. Additionally, it may exhibit specific solubility characteristics in aqueous solutions, influenced by the amino acid side chains. This compound can be utilized in research related to peptide synthesis, drug development, and understanding protein interactions. Its structural properties may also allow it to participate in various biochemical pathways, making it of interest in fields such as biochemistry and pharmacology.
Formula:C8H15N3O5
InChI:InChI=1/C8H15N3O5/c1-4(9)7(15)11-5(3-12)8(16)10-2-6(13)14/h4-5,12H,2-3,9H2,1H3,(H,10,16)(H,11,15)(H,13,14)/t4-,5-/m0/s1
Synonyms:- alanyl-seryl-glycine
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
