CymitQuimica logo

CAS 874948-63-7

:

Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin,4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-, 4-oxide, (11bS)-

Description:
Dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepin, 4-hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]-, 4-oxide, with CAS number 874948-63-7, is a complex organophosphorus compound characterized by its unique structural framework that includes a dioxaphosphepin core. This compound features multiple aromatic substituents, specifically bis(2,4,6-tris(1-methylethyl)phenyl) groups, which contribute to its stability and potentially influence its electronic properties. The presence of a hydroxy group enhances its reactivity and solubility in various solvents. As a phosphine oxide derivative, it may exhibit interesting photophysical properties, making it relevant in fields such as materials science and organic electronics. The compound's intricate structure suggests potential applications in catalysis, as well as in the development of advanced materials. However, detailed studies on its specific reactivity, stability, and potential applications are necessary to fully understand its characteristics and utility in various chemical contexts.
Formula:C50H57O4P
InChI:InChI=1S/C50H57O4P/c1-27(2)35-23-39(29(5)6)45(40(24-35)30(7)8)43-21-33-17-13-15-19-37(33)47-48-38-20-16-14-18-34(38)22-44(50(48)54-55(51,52)53-49(43)47)46-41(31(9)10)25-36(28(3)4)26-42(46)32(11)12/h13-32H,1-12H3,(H,51,52)
InChI key:AGQAQYPGJDBIQR-UHFFFAOYSA-N
SMILES:CC(C)C1=CC(=C(C(=C1)C(C)C)C2=CC3=CC=CC=C3C4=C2OP(=O)(OC5=C4C6=CC=CC=C6C=C5C7=C(C=C(C=C7C(C)C)C(C)C)C(C)C)O)C(C)C
Synonyms:
  • (S)-TRIP, (11bS)-4-Hydroxy-2,6-bis[2,4,6-tris(1-methylethyl)phenyl]dinaphtho[2,1-d:1μ,2μ-f]-1,3,2-dioxaphosphepin 4-oxide, (S)-3,3μ-Bis(2,4,6-triisopropylphenyl)-1,1μ-bi-2-naphthol cyclic monophosphate
  • (6r,11bR)-4-hydroxy-2,6-bis(2,4,6-triisopropylphenyl)dinaphtho[2,1-d:1',2'-f][1,3,2]dioxaphosphepine 4-oxide
Found 6 products.